C36H62N4Ni — CID 133108695
nickel(2+);2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,22,24-octadecahydroporphyrin-21,23-diide (PubChem CID 133108695) has the molecular formula C36H62N4Ni and a molecular weight of 609.61 g/mol. Its IUPAC name is nickel(2+);2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,22,24-octadecahydroporphyrin-21,23-diide.
| Compound Name | nickel(2+);2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,22,24-octadecahydroporphyrin-21,23-diide |
|---|---|
| PubChem CID | 133108695 |
| Molecular Formula | C36H62N4Ni |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | nickel(2+);2,3,7,8,12,13,17,18-octaethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,22,24-octadecahydroporphyrin-21,23-diide |
| SMILES | CCC1=C(CC)C2CC3[N-]C(CC4NC(CC5[N-]C(CC1N2)C(CC)C5CC)C(CC)=C4CC)C(CC)C3CC.[Ni+2] |
| InChI | InChI=1S/C36H62N4.Ni/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h21-22,27-36,38-39H,9-20H2,1-8H3;/q-2;+2 |
| InChIKey | HCTOQDLLLGOMGN-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 52.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|