C33H52N4O5 — CID 133108710
3-[18-(2-carboxyethyl)-8-ethenyl-13-(hydroxymethyl)-3,7,12,17-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin-2-yl]propanoic acid (PubChem CID 133108710) has the molecular formula C33H52N4O5 and a molecular weight of 584.80 g/mol. Its IUPAC name is 3-[18-(2-carboxyethyl)-8-ethenyl-13-(hydroxymethyl)-3,7,12,17-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-(2-carboxyethyl)-8-ethenyl-13-(hydroxymethyl)-3,7,12,17-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 133108710 |
| Molecular Formula | C33H52N4O5 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8-ethenyl-13-(hydroxymethyl)-3,7,12,17-tetramethyl-1,2,3,4,5,6,9,10,11,12,13,14,15,16,19,20,21,22,23,24-icosahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)C2CC3NC(CC4NC(CC5NC(CC1N2)C(C)C5CO)C(C)=C4CCC(=O)O)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C33H52N4O5/c1-6-20-16(2)24-11-25-17(3)21(7-9-32(39)40)29(35-25)14-30-22(8-10-33(41)42)18(4)26(36-30)13-31-23(15-38)19(5)27(37-31)12-28(20)34-24/h6,17,19,21,23-31,34-38H,1,7-15H2,2-5H3,(H,39,40)(H,41,42) |
| InChIKey | PICGUGZBFCASIL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 142.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|