About (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride
(2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride (PubChem CID 133108722) has the molecular formula C17H22ClNO3
and a molecular weight of 323.82 g/mol. Its IUPAC name is (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride.
Molecular Properties
| Compound Name | (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride |
| PubChem CID | 133108722 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)/C(=C\C1CCNCC1)C2.Cl |
| InChI | InChI=1S/C17H21NO3.ClH/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2;/h7,9-11,18H,3-6,8H2,1-2H3;1H/b13-7-; |
| InChIKey | KFFKWPMEJZJPSI-QCCGTXRUSA-N |
| XLogP | 2.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride?
The IUPAC name of (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride (CID 133108722) is (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride.
What is the SMILES notation for (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride?
The canonical SMILES for (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride is COc1cc2c(cc1OC)C(=O)/C(=C\C1CCNCC1)C2.Cl.
What is the InChIKey of (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride?
The InChIKey is KFFKWPMEJZJPSI-QCCGTXRUSA-N. The full InChI is InChI=1S/C17H21NO3.ClH/c1-20-15-9-12-8-13(7-11-3-5-18-6-4-11)17(19)14(12)10-16(15)21-2;/h7,9-11,18H,3-6,8H2,1-2H3;1H/b13-7-;.
What are the key properties of (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride?
(2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5,6-dimethoxy-2-(piperidin-4-ylmethylidene)-3H-inden-1-one;hydrochloride is sourced from PubChem (CID 133108722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).