C17H24N2O4S2 — CID 133110071
2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 133110071) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 133110071 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]sulfonyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(S(=O)(=O)N2CC[C@H]3CCCC[C@H]3C2)sc2c1CCNC2 |
| InChI | InChI=1S/C17H24N2O4S2/c20-16(21)15-13-5-7-18-9-14(13)24-17(15)25(22,23)19-8-6-11-3-1-2-4-12(11)10-19/h11-12,18H,1-10H2,(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | RULRKOSPCOYOSA-NEPJUHHUSA-N |
| XLogP | 2.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |