C21H21N3O4 — CID 133110360
methyl (1R,3S,3aR,6aS)-3,5-dimethyl-4,6-dioxo-1-(4-pyridin-4-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 133110360) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-3,5-dimethyl-4,6-dioxo-1-(4-pyridin-4-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-3,5-dimethyl-4,6-dioxo-1-(4-pyridin-4-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 133110360 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-3,5-dimethyl-4,6-dioxo-1-(4-pyridin-4-ylphenyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2ccc(-c3ccncc3)cc2)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C21H21N3O4/c1-21(20(27)28-3)16-15(18(25)24(2)19(16)26)17(23-21)14-6-4-12(5-7-14)13-8-10-22-11-9-13/h4-11,15-17,23H,1-3H3/t15-,16-,17-,21-/m0/s1 |
| InChIKey | GDIRPAIEEJKYFN-IAGYGMIVSA-N |
| XLogP | 1.56 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|