C19H21FN2O2S — CID 133110505
[(3aR,6aR)-1-[(2-fluoro-5-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-thiophen-3-ylmethanone (PubChem CID 133110505) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is [(3aR,6aR)-1-[(2-fluoro-5-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3aR,6aR)-1-[(2-fluoro-5-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 133110505 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [(3aR,6aR)-1-[(2-fluoro-5-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
| SMILES | COc1ccc(F)c(CN2CC[C@@H]3CN(C(=O)c4ccsc4)C[C@@H]32)c1 |
| InChI | InChI=1S/C19H21FN2O2S/c1-24-16-2-3-17(20)15(8-16)10-21-6-4-13-9-22(11-18(13)21)19(23)14-5-7-25-12-14/h2-3,5,7-8,12-13,18H,4,6,9-11H2,1H3/t13-,18+/m1/s1 |
| InChIKey | XGKNORMLZYAONU-ACJLOTCBSA-N |
| XLogP | 3.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |