C12H17F3N4O3S — CID 133110748
(4aS,7aR)-1-ethyl-4-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133110748) has the molecular formula C12H17F3N4O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is (4aS,7aR)-1-ethyl-4-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-ethyl-4-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133110748 |
| Molecular Formula | C12H17F3N4O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (4aS,7aR)-1-ethyl-4-[[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCN1CCN(Cc2nc(C(F)(F)F)no2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H17F3N4O3S/c1-2-18-3-4-19(9-7-23(20,21)6-8(9)18)5-10-16-11(17-22-10)12(13,14)15/h8-9H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | XKGKKMWTGVCBTE-DTWKUNHWSA-N |
| XLogP | 0.39 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |