C18H27N3O2 — CID 133110810
3-ethoxy-1-[(1R,5S)-3-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one (PubChem CID 133110810) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-ethoxy-1-[(1R,5S)-3-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one.
| Compound Name | 3-ethoxy-1-[(1R,5S)-3-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
|---|---|
| PubChem CID | 133110810 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-ethoxy-1-[(1R,5S)-3-(pyridin-2-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
| SMILES | CCOCCC(=O)N1C[C@@H]2CC[C@H]1CN(Cc1ccccn1)C2 |
| InChI | InChI=1S/C18H27N3O2/c1-2-23-10-8-18(22)21-12-15-6-7-17(21)14-20(11-15)13-16-5-3-4-9-19-16/h3-5,9,15,17H,2,6-8,10-14H2,1H3/t15-,17+/m1/s1 |
| InChIKey | MBDUNNQZFZHSAG-WBVHZDCISA-N |
| XLogP | 1.93 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|