C20H16F12N2 — CID 13311177
4,4,12,12-tetrakis(trifluoromethyl)-3,11-diazahexacyclo[12.2.1.16,9.02,13.03,11.05,10]octadeca-7,15-diene (PubChem CID 13311177) has the molecular formula C20H16F12N2 and a molecular weight of 512.34 g/mol. Its IUPAC name is 4,4,12,12-tetrakis(trifluoromethyl)-3,11-diazahexacyclo[12.2.1.16,9.02,13.03,11.05,10]octadeca-7,15-diene.
| Compound Name | 4,4,12,12-tetrakis(trifluoromethyl)-3,11-diazahexacyclo[12.2.1.16,9.02,13.03,11.05,10]octadeca-7,15-diene |
|---|---|
| PubChem CID | 13311177 |
| Molecular Formula | C20H16F12N2 |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 4,4,12,12-tetrakis(trifluoromethyl)-3,11-diazahexacyclo[12.2.1.16,9.02,13.03,11.05,10]octadeca-7,15-diene |
| SMILES | FC(F)(F)C1(C(F)(F)F)C2C3C=CC(C3)C2N2N1C1C3C=CC(C3)C1C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H16F12N2/c21-17(22,23)15(18(24,25)26)11-7-1-3-9(5-7)13(11)33-16(19(27,28)29,20(30,31)32)12-8-2-4-10(6-8)14(12)34(15)33/h1-4,7-14H,5-6H2 |
| InChIKey | CHUKZXLHXSZUBL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|