About cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron
cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron (PubChem CID 133112729) has the molecular formula C15H23FeNO4
and a molecular weight of 337.20 g/mol. Its IUPAC name is cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron.
Molecular Properties
| Compound Name | cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron |
| PubChem CID | 133112729 |
| Molecular Formula | C15H23FeNO4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron |
| SMILES | C1CCCC1.O=C(ON1C(=O)CCC1=O)C1CCCC1.[Fe] |
| InChI | InChI=1S/C10H13NO4.C5H10.Fe/c12-8-5-6-9(13)11(8)15-10(14)7-3-1-2-4-7;1-2-4-5-3-1;/h7H,1-6H2;1-5H2; |
| InChIKey | IVDPSPXUPRIYJB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron?
The IUPAC name of cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron (CID 133112729) is cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron.
What is the SMILES notation for cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron?
The canonical SMILES for cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron is C1CCCC1.O=C(ON1C(=O)CCC1=O)C1CCCC1.[Fe].
What is the InChIKey of cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron?
The InChIKey is IVDPSPXUPRIYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4.C5H10.Fe/c12-8-5-6-9(13)11(8)15-10(14)7-3-1-2-4-7;1-2-4-5-3-1;/h7H,1-6H2;1-5H2;.
What are the key properties of cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron?
cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron has a molecular weight of 337.20 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;(2,5-dioxopyrrolidin-1-yl) cyclopentanecarboxylate;iron is sourced from PubChem (CID 133112729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).