carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium

C12H20O2Rh — CID 133112924

IUPACcarbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium
SMILESCC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Rh]
InChIInChI=1S/C10H20.2CO.Rh/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;
InChIKeyALXAUGXWLGJFMO-UHFFFAOYSA-N
MW299.20 g/mol
LogP3.10
Rot. Bonds

About carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium

carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium (PubChem CID 133112924) has the molecular formula C12H20O2Rh and a molecular weight of 299.20 g/mol. Its IUPAC name is carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium.

Molecular Properties

Compound Namecarbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium
PubChem CID133112924
Molecular FormulaC12H20O2Rh
Molecular Weight299.20 g/mol
Exact Mass299.05
IUPAC Namecarbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium
SMILESCC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Rh]
InChIInChI=1S/C10H20.2CO.Rh/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;
InChIKeyALXAUGXWLGJFMO-UHFFFAOYSA-N
XLogP3.10
TPSA39.80 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.20
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium?
The IUPAC name of carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium (CID 133112924) is carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium.
What is the SMILES notation for carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium?
The canonical SMILES for carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium is CC1C(C)C(C)C(C)C1C.[C-]#[O+].[C-]#[O+].[Rh].
What is the InChIKey of carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium?
The InChIKey is ALXAUGXWLGJFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.2CO.Rh/c1-6-7(2)9(4)10(5)8(6)3;2*1-2;/h6-10H,1-5H3;;;.
What are the key properties of carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium?
carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium has a molecular weight of 299.20 g/mol, XLogP of 3.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;1,2,3,4,5-pentamethylcyclopentane;rhodium is sourced from PubChem (CID 133112924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).