C17H24N6OS — CID 133113862
(1S,2S)-1-[2-(1-methyltetrazol-5-yl)sulfanylethylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (PubChem CID 133113862) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is (1S,2S)-1-[2-(1-methyltetrazol-5-yl)sulfanylethylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
| Compound Name | (1S,2S)-1-[2-(1-methyltetrazol-5-yl)sulfanylethylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
|---|---|
| PubChem CID | 133113862 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (1S,2S)-1-[2-(1-methyltetrazol-5-yl)sulfanylethylamino]spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| SMILES | Cn1nnnc1SCCN[C@H]1c2ccccc2C2(CCNCC2)[C@@H]1O |
| InChI | InChI=1S/C17H24N6OS/c1-23-16(20-21-22-23)25-11-10-19-14-12-4-2-3-5-13(12)17(15(14)24)6-8-18-9-7-17/h2-5,14-15,18-19,24H,6-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | ZILWMULXMDVJQR-LSDHHAIUSA-N |
| XLogP | 0.63 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|