C21H24N4O4 — CID 133115190
6-[(2S,3R,6S)-3-(2-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 133115190) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-[(2S,3R,6S)-3-(2-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(2S,3R,6S)-3-(2-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 133115190 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 6-[(2S,3R,6S)-3-(2-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccccc1[C@@H]1CN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)[C@H]2C3CCN(CC3)[C@@H]12 |
| InChI | InChI=1S/C21H24N4O4/c1-29-16-5-3-2-4-13(16)14-11-25(18-12-6-8-24(9-7-12)19(14)18)20(27)15-10-17(26)23-21(28)22-15/h2-5,10,12,14,18-19H,6-9,11H2,1H3,(H2,22,23,26,28)/t14-,18-,19-/m0/s1 |
| InChIKey | BUBULEHBLDUMQW-JVPBZIDWSA-N |
| XLogP | 0.77 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |