C16H24N6O4S — CID 133115313
3-[2-[[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]amino]ethyl]-1,3-oxazinan-2-one (PubChem CID 133115313) has the molecular formula C16H24N6O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[2-[[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]amino]ethyl]-1,3-oxazinan-2-one.
| Compound Name | 3-[2-[[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]amino]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 133115313 |
| Molecular Formula | C16H24N6O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-[2-[[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]amino]ethyl]-1,3-oxazinan-2-one |
| SMILES | O=C1OCCCN1CCNc1nccc(N2CCN[C@@H]3CS(=O)(=O)C[C@@H]32)n1 |
| InChI | InChI=1S/C16H24N6O4S/c23-16-21(6-1-9-26-16)7-4-19-15-18-3-2-14(20-15)22-8-5-17-12-10-27(24,25)11-13(12)22/h2-3,12-13,17H,1,4-11H2,(H,18,19,20)/t12-,13+/m1/s1 |
| InChIKey | YARLBYPTBGEWHW-OLZOCXBDSA-N |
| XLogP | -0.69 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |