C21H26N2O4 — CID 133115418
methyl 2-[[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-1,3-oxazole-4-carboxylate (PubChem CID 133115418) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 2-[[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 133115418 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl 2-[[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]methyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CN2CC[C@](O)(c3ccccc3)[C@@H]3CCCC[C@H]32)n1 |
| InChI | InChI=1S/C21H26N2O4/c1-26-20(24)17-14-27-19(22-17)13-23-12-11-21(25,15-7-3-2-4-8-15)16-9-5-6-10-18(16)23/h2-4,7-8,14,16,18,25H,5-6,9-13H2,1H3/t16-,18-,21+/m1/s1 |
| InChIKey | LNEZLCTWVIRAIJ-BLIXFSHQSA-N |
| XLogP | 3.11 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |