C16H20ClF2NO2 — CID 133115979
2-(2-chloro-4,5-difluorophenyl)-1-[(4R)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]ethanone (PubChem CID 133115979) has the molecular formula C16H20ClF2NO2 and a molecular weight of 331.79 g/mol. Its IUPAC name is 2-(2-chloro-4,5-difluorophenyl)-1-[(4R)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-4,5-difluorophenyl)-1-[(4R)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 133115979 |
| Molecular Formula | C16H20ClF2NO2 |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-(2-chloro-4,5-difluorophenyl)-1-[(4R)-4-hydroxy-3,3,4-trimethylpiperidin-1-yl]ethanone |
| SMILES | CC1(C)CN(C(=O)Cc2cc(F)c(F)cc2Cl)CC[C@@]1(C)O |
| InChI | InChI=1S/C16H20ClF2NO2/c1-15(2)9-20(5-4-16(15,3)22)14(21)7-10-6-12(18)13(19)8-11(10)17/h6,8,22H,4-5,7,9H2,1-3H3/t16-/m1/s1 |
| InChIKey | GQYODAHUYGBLGA-MRXNPFEDSA-N |
| XLogP | 3.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|