C19H24N2O4S — CID 133116136
3-[[(4aR,7aS)-4-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenol (PubChem CID 133116136) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-[[(4aR,7aS)-4-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenol.
| Compound Name | 3-[[(4aR,7aS)-4-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 133116136 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[[(4aR,7aS)-4-[(5-methylfuran-2-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenol |
| SMILES | Cc1ccc(CN2CCN(Cc3cccc(O)c3)[C@@H]3CS(=O)(=O)C[C@@H]32)o1 |
| InChI | InChI=1S/C19H24N2O4S/c1-14-5-6-17(25-14)11-21-8-7-20(10-15-3-2-4-16(22)9-15)18-12-26(23,24)13-19(18)21/h2-6,9,18-19,22H,7-8,10-13H2,1H3/t18-,19+/m1/s1 |
| InChIKey | DQNZSWGCMNVUBC-MOPGFXCFSA-N |
| XLogP | 1.78 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |