C23H27N3O3 — CID 133116370
(3aR,6aR)-2-[(2-ethylphenyl)methyl]-5-(6-methylpyridine-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133116370) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (3aR,6aR)-2-[(2-ethylphenyl)methyl]-5-(6-methylpyridine-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-[(2-ethylphenyl)methyl]-5-(6-methylpyridine-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133116370 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (3aR,6aR)-2-[(2-ethylphenyl)methyl]-5-(6-methylpyridine-2-carbonyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCc1ccccc1CN1C[C@@H]2CN(C(=O)c3cccc(C)n3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C23H27N3O3/c1-3-17-8-4-5-9-18(17)11-25-12-19-13-26(15-23(19,14-25)22(28)29)21(27)20-10-6-7-16(2)24-20/h4-10,19H,3,11-15H2,1-2H3,(H,28,29)/t19-,23-/m1/s1 |
| InChIKey | GPNFWXXCWROQJV-AUSIDOKSSA-N |
| XLogP | 2.61 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |