About 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid
5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid (PubChem CID 133116488) has the molecular formula C19H24N4O4
and a molecular weight of 372.43 g/mol. Its IUPAC name is 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid.
Molecular Properties
| Compound Name | 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid |
| PubChem CID | 133116488 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid |
| SMILES | CCOc1ccc(-c2ccnc(N3C[C@@H](O)[C@H](N(C)C)C3)n2)cc1C(=O)O |
| InChI | InChI=1S/C19H24N4O4/c1-4-27-17-6-5-12(9-13(17)18(25)26)14-7-8-20-19(21-14)23-10-15(22(2)3)16(24)11-23/h5-9,15-16,24H,4,10-11H2,1-3H3,(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | SYPMSOSRWCVHIO-HZPDHXFCSA-N |
| XLogP | 1.35 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The IUPAC name of 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid (CID 133116488) is 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid.
What is the SMILES notation for 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The canonical SMILES for 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid is CCOc1ccc(-c2ccnc(N3C[C@@H](O)[C@H](N(C)C)C3)n2)cc1C(=O)O.
What is the InChIKey of 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The InChIKey is SYPMSOSRWCVHIO-HZPDHXFCSA-N. The full InChI is InChI=1S/C19H24N4O4/c1-4-27-17-6-5-12(9-13(17)18(25)26)14-7-8-20-19(21-14)23-10-15(22(2)3)16(24)11-23/h5-9,15-16,24H,4,10-11H2,1-3H3,(H,25,26)/t15-,16-/m1/s1.
What are the key properties of 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid?
5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid has a molecular weight of 372.43 g/mol, XLogP of 1.35, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(3R,4R)-3-(dimethylamino)-4-hydroxypyrrolidin-1-yl]pyrimidin-4-yl]-2-ethoxybenzoic acid is sourced from PubChem (CID 133116488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).