C21H26N4O3 — CID 133117026
(1R,5R,6S,7S)-3-cyclohexyl-6-(6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 133117026) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (1R,5R,6S,7S)-3-cyclohexyl-6-(6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,5R,6S,7S)-3-cyclohexyl-6-(6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 133117026 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1R,5R,6S,7S)-3-cyclohexyl-6-(6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | O=C([C@@H]1[C@@H]2C=C[C@@]3(CN(C4CCCCC4)C(=O)[C@H]13)O2)N1CCn2cncc2C1 |
| InChI | InChI=1S/C21H26N4O3/c26-19(23-8-9-24-13-22-10-15(24)11-23)17-16-6-7-21(28-16)12-25(20(27)18(17)21)14-4-2-1-3-5-14/h6-7,10,13-14,16-18H,1-5,8-9,11-12H2/t16-,17+,18-,21-/m0/s1 |
| InChIKey | QUBSFBKBPSHZAK-NYUBLWNDSA-N |
| XLogP | 1.34 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|