C15H24N6O2S — CID 133118239
cis-(1R,2S)-1-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-N-prop-2-enylcyclohexane-1,2-dicarboxamide (PubChem CID 133118239) has the molecular formula C15H24N6O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is cis-(1R,2S)-1-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-N-prop-2-enylcyclohexane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-N-prop-2-enylcyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 133118239 |
| Molecular Formula | C15H24N6O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | cis-(1R,2S)-1-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-2-N-prop-2-enylcyclohexane-1,2-dicarboxamide |
| SMILES | C=CCNC(=O)[C@H]1CCCC[C@H]1C(=O)NCCSc1nnnn1C |
| InChI | InChI=1S/C15H24N6O2S/c1-3-8-16-13(22)11-6-4-5-7-12(11)14(23)17-9-10-24-15-18-19-20-21(15)2/h3,11-12H,1,4-10H2,2H3,(H,16,22)(H,17,23)/t11-,12+/m0/s1 |
| InChIKey | GYKWMTDZENFTNQ-NWDGAFQWSA-N |
| XLogP | 0.53 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|