C17H30N2O — CID 133118456
(4aS,8aR)-1-butyl-6-(3-methylbut-2-enyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133118456) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is (4aS,8aR)-1-butyl-6-(3-methylbut-2-enyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-butyl-6-(3-methylbut-2-enyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133118456 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (4aS,8aR)-1-butyl-6-(3-methylbut-2-enyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCCN1C(=O)CC[C@H]2CN(CC=C(C)C)CC[C@H]21 |
| InChI | InChI=1S/C17H30N2O/c1-4-5-10-19-16-9-12-18(11-8-14(2)3)13-15(16)6-7-17(19)20/h8,15-16H,4-7,9-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | YMDCCYPYFSBWCD-JKSUJKDBSA-N |
| XLogP | 3.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|