About 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide
2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide (PubChem CID 133118988) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide |
| PubChem CID | 133118988 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NC[C@@H]1CNC[C@H]1CO |
| InChI | InChI=1S/C18H30N2O2/c21-11-16-9-19-8-15(16)10-20-17(22)7-18-4-12-1-13(5-18)3-14(2-12)6-18/h12-16,19,21H,1-11H2,(H,20,22)/t12?,13?,14?,15-,16-,18?/m0/s1 |
| InChIKey | JEMKKONPNKNIJW-OJYUVLBFSA-N |
| XLogP | 1.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide?
The IUPAC name of 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide (CID 133118988) is 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide.
What is the SMILES notation for 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide?
The canonical SMILES for 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide is O=C(CC12CC3CC(CC(C3)C1)C2)NC[C@@H]1CNC[C@H]1CO.
What is the InChIKey of 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide?
The InChIKey is JEMKKONPNKNIJW-OJYUVLBFSA-N. The full InChI is InChI=1S/C18H30N2O2/c21-11-16-9-19-8-15(16)10-20-17(22)7-18-4-12-1-13(5-18)3-14(2-12)6-18/h12-16,19,21H,1-11H2,(H,20,22)/t12?,13?,14?,15-,16-,18?/m0/s1.
What are the key properties of 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide?
2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide has a molecular weight of 306.45 g/mol, XLogP of 1.54, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N-[[(3S,4S)-4-(hydroxymethyl)pyrrolidin-3-yl]methyl]acetamide is sourced from PubChem (CID 133118988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).