About 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine
4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine (PubChem CID 133119156) has the molecular formula C14H23FN4O2S
and a molecular weight of 330.43 g/mol. Its IUPAC name is 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine.
Molecular Properties
| Compound Name | 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine |
| PubChem CID | 133119156 |
| Molecular Formula | C14H23FN4O2S |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine |
| SMILES | CCC[C@@H]1CN(c2ccncc2F)C[C@H]1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H23FN4O2S/c1-4-5-11-9-19(14-6-7-16-8-12(14)15)10-13(11)17-22(20,21)18(2)3/h6-8,11,13,17H,4-5,9-10H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | CAIJAWXANGDUGZ-DGCLKSJQSA-N |
| XLogP | 1.22 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine?
The IUPAC name of 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine (CID 133119156) is 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine.
What is the SMILES notation for 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine?
The canonical SMILES for 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine is CCC[C@@H]1CN(c2ccncc2F)C[C@H]1NS(=O)(=O)N(C)C.
What is the InChIKey of 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine?
The InChIKey is CAIJAWXANGDUGZ-DGCLKSJQSA-N. The full InChI is InChI=1S/C14H23FN4O2S/c1-4-5-11-9-19(14-6-7-16-8-12(14)15)10-13(11)17-22(20,21)18(2)3/h6-8,11,13,17H,4-5,9-10H2,1-3H3/t11-,13-/m1/s1.
What are the key properties of 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine?
4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine has a molecular weight of 330.43 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propylpyrrolidin-1-yl]-3-fluoropyridine is sourced from PubChem (CID 133119156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).