C15H21N5O2 — CID 133119479
[(3aR,6aR)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-morpholin-4-ylmethanone (PubChem CID 133119479) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is [(3aR,6aR)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aR,6aR)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133119479 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | [(3aR,6aR)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CC[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C15H21N5O2/c21-15(18-6-8-22-9-7-18)20-5-2-12-10-19(11-13(12)20)14-16-3-1-4-17-14/h1,3-4,12-13H,2,5-11H2/t12-,13+/m1/s1 |
| InChIKey | NUYBGUUTHMSFSR-OLZOCXBDSA-N |
| XLogP | 0.44 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |