C19H28N6O — CID 133119531
[(4aR,8aS)-1-[(1-ethylpyrazol-4-yl)methyl]-6-pyrazin-2-yl-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol (PubChem CID 133119531) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is [(4aR,8aS)-1-[(1-ethylpyrazol-4-yl)methyl]-6-pyrazin-2-yl-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aR,8aS)-1-[(1-ethylpyrazol-4-yl)methyl]-6-pyrazin-2-yl-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 133119531 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [(4aR,8aS)-1-[(1-ethylpyrazol-4-yl)methyl]-6-pyrazin-2-yl-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4a-yl]methanol |
| SMILES | CCn1cc(CN2CCC[C@@]3(CO)CN(c4cnccn4)CC[C@H]23)cn1 |
| InChI | InChI=1S/C19H28N6O/c1-2-25-13-16(10-22-25)12-23-8-3-5-19(15-26)14-24(9-4-17(19)23)18-11-20-6-7-21-18/h6-7,10-11,13,17,26H,2-5,8-9,12,14-15H2,1H3/t17-,19-/m0/s1 |
| InChIKey | RPMIWXNRPGADCQ-HKUYNNGSSA-N |
| XLogP | 1.55 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |