C19H22F2N4 — CID 133119877
(2S,3R,6S)-3-(2,3-difluorophenyl)-5-(1H-imidazol-5-ylmethyl)-1,5-diazatricyclo[5.2.2.02,6]undecane (PubChem CID 133119877) has the molecular formula C19H22F2N4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S,3R,6S)-3-(2,3-difluorophenyl)-5-(1H-imidazol-5-ylmethyl)-1,5-diazatricyclo[5.2.2.02,6]undecane.
| Compound Name | (2S,3R,6S)-3-(2,3-difluorophenyl)-5-(1H-imidazol-5-ylmethyl)-1,5-diazatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 133119877 |
| Molecular Formula | C19H22F2N4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2S,3R,6S)-3-(2,3-difluorophenyl)-5-(1H-imidazol-5-ylmethyl)-1,5-diazatricyclo[5.2.2.02,6]undecane |
| SMILES | Fc1cccc([C@@H]2CN(Cc3cnc[nH]3)[C@H]3C4CCN(CC4)[C@@H]23)c1F |
| InChI | InChI=1S/C19H22F2N4/c20-16-3-1-2-14(17(16)21)15-10-25(9-13-8-22-11-23-13)18-12-4-6-24(7-5-12)19(15)18/h1-3,8,11-12,15,18-19H,4-7,9-10H2,(H,22,23)/t15-,18-,19-/m0/s1 |
| InChIKey | DYVKAAHNBLSFCC-SNRMKQJTSA-N |
| XLogP | 2.75 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |