C20H22N4O4 — CID 133120126
methyl (1R,3S,3aR,6aS)-3-ethyl-5-methyl-4,6-dioxo-1-(1-phenylpyrazol-4-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 133120126) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-3-ethyl-5-methyl-4,6-dioxo-1-(1-phenylpyrazol-4-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-3-ethyl-5-methyl-4,6-dioxo-1-(1-phenylpyrazol-4-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 133120126 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-3-ethyl-5-methyl-4,6-dioxo-1-(1-phenylpyrazol-4-yl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CC[C@]1(C(=O)OC)N[C@@H](c2cnn(-c3ccccc3)c2)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C20H22N4O4/c1-4-20(19(27)28-3)15-14(17(25)23(2)18(15)26)16(22-20)12-10-21-24(11-12)13-8-6-5-7-9-13/h5-11,14-16,22H,4H2,1-3H3/t14-,15-,16-,20-/m0/s1 |
| InChIKey | ZDHFIIKVACGUKQ-ULMVMLMRSA-N |
| XLogP | 1.07 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|