C22H20N2O6 — CID 1331202
ethyl 1-(4-methoxyphenyl)-2-methyl-4-[(4-nitrophenyl)methylidene]-5-oxopyrrole-3-carboxylate (PubChem CID 1331202) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is ethyl 1-(4-methoxyphenyl)-2-methyl-4-[(4-nitrophenyl)methylidene]-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl 1-(4-methoxyphenyl)-2-methyl-4-[(4-nitrophenyl)methylidene]-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 1331202 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | ethyl 1-(4-methoxyphenyl)-2-methyl-4-[(4-nitrophenyl)methylidene]-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(OC)cc2)C(=O)C1=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N2O6/c1-4-30-22(26)20-14(2)23(16-9-11-18(29-3)12-10-16)21(25)19(20)13-15-5-7-17(8-6-15)24(27)28/h5-13H,4H2,1-3H3 |
| InChIKey | KRDBOPCHUCHBPF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|