C17H25N3O2 — CID 133120595
(3aR,7aS)-2-[(5-ethyl-2-pyridinyl)methyl]-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid (PubChem CID 133120595) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (3aR,7aS)-2-[(5-ethyl-2-pyridinyl)methyl]-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid.
| Compound Name | (3aR,7aS)-2-[(5-ethyl-2-pyridinyl)methyl]-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
|---|---|
| PubChem CID | 133120595 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3aR,7aS)-2-[(5-ethyl-2-pyridinyl)methyl]-5-methyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
| SMILES | CCc1ccc(CN2C[C@H]3CCN(C)C[C@@]3(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-13-4-5-15(18-8-13)10-20-9-14-6-7-19(2)11-17(14,12-20)16(21)22/h4-5,8,14H,3,6-7,9-12H2,1-2H3,(H,21,22)/t14-,17-/m1/s1 |
| InChIKey | FEUQXBOBQGVIER-RHSMWYFYSA-N |
| XLogP | 1.48 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |