C17H23N5O2S — CID 133120732
(1R,5S)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 133120732) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is (1R,5S)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1R,5S)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 133120732 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (1R,5S)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CCc1nnc(N2C[C@H]3CC[C@@H](C2)N(Cc2c(C)noc2C)C3=O)s1 |
| InChI | InChI=1S/C17H23N5O2S/c1-4-15-18-19-17(25-15)21-7-12-5-6-13(8-21)22(16(12)23)9-14-10(2)20-24-11(14)3/h12-13H,4-9H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | NHRSJNHQCRCTQN-OLZOCXBDSA-N |
| XLogP | 2.33 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |