C19H31N3O4 — CID 133120887
anilino (2R)-2-[[(2R)-2-(2-hydroxyethylamino)-3-methylbutanoyl]amino]-4-methylpentanoate (PubChem CID 133120887) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is anilino (2R)-2-[[(2R)-2-(2-hydroxyethylamino)-3-methylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | anilino (2R)-2-[[(2R)-2-(2-hydroxyethylamino)-3-methylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 133120887 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | anilino (2R)-2-[[(2R)-2-(2-hydroxyethylamino)-3-methylbutanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](NCCO)C(C)C)C(=O)ONc1ccccc1 |
| InChI | InChI=1S/C19H31N3O4/c1-13(2)12-16(19(25)26-22-15-8-6-5-7-9-15)21-18(24)17(14(3)4)20-10-11-23/h5-9,13-14,16-17,20,22-23H,10-12H2,1-4H3,(H,21,24)/t16-,17-/m1/s1 |
| InChIKey | FIIVKTTWIVWFHF-IAGOWNOFSA-N |
| XLogP | 1.69 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|