C18H27N3O — CID 133120937
4-[(1R,5S)-6-benzyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]butanamide (PubChem CID 133120937) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-[(1R,5S)-6-benzyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]butanamide.
| Compound Name | 4-[(1R,5S)-6-benzyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]butanamide |
|---|---|
| PubChem CID | 133120937 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 4-[(1R,5S)-6-benzyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]butanamide |
| SMILES | NC(=O)CCCN1C[C@H]2CC[C@@H](C1)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H27N3O/c19-18(22)7-4-10-20-11-16-8-9-17(14-20)21(13-16)12-15-5-2-1-3-6-15/h1-3,5-6,16-17H,4,7-14H2,(H2,19,22)/t16-,17+/m1/s1 |
| InChIKey | WGWJOFAHHROSIR-SJORKVTESA-N |
| XLogP | 1.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |