C18H27FN4O2S — CID 133122244
(4aS,7aR)-1-ethyl-4-[[3-(3-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133122244) has the molecular formula C18H27FN4O2S and a molecular weight of 382.51 g/mol. Its IUPAC name is (4aS,7aR)-1-ethyl-4-[[3-(3-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-ethyl-4-[[3-(3-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133122244 |
| Molecular Formula | C18H27FN4O2S |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (4aS,7aR)-1-ethyl-4-[[3-(3-fluorophenyl)pyrazolidin-4-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCN1CCN(CC2CNNC2c2cccc(F)c2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H27FN4O2S/c1-2-22-6-7-23(17-12-26(24,25)11-16(17)22)10-14-9-20-21-18(14)13-4-3-5-15(19)8-13/h3-5,8,14,16-18,20-21H,2,6-7,9-12H2,1H3/t14?,16-,17+,18?/m0/s1 |
| InChIKey | XPGWTHQAFHJMST-FFDQMNFHSA-N |
| XLogP | 0.39 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |