C22H32N2O3S — CID 133122745
(3R,4R)-4-[1-adamantylmethyl(methyl)amino]-1-(benzenesulfonyl)pyrrolidin-3-ol (PubChem CID 133122745) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is (3R,4R)-4-[1-adamantylmethyl(methyl)amino]-1-(benzenesulfonyl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[1-adamantylmethyl(methyl)amino]-1-(benzenesulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 133122745 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3R,4R)-4-[1-adamantylmethyl(methyl)amino]-1-(benzenesulfonyl)pyrrolidin-3-ol |
| SMILES | CN(CC12CC3CC(CC(C3)C1)C2)[C@@H]1CN(S(=O)(=O)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C22H32N2O3S/c1-23(15-22-10-16-7-17(11-22)9-18(8-16)12-22)20-13-24(14-21(20)25)28(26,27)19-5-3-2-4-6-19/h2-6,16-18,20-21,25H,7-15H2,1H3/t16?,17?,18?,20-,21-,22?/m1/s1 |
| InChIKey | FRUXCJLGZKDGEV-HXTOSXCISA-N |
| XLogP | 2.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |