C22H34N4O2 — CID 133122890
(3aS,6aS)-5-[[2-(cyclopentylmethyl)-1H-imidazol-5-yl]methyl]-2-(3-methylbut-2-enyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133122890) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (3aS,6aS)-5-[[2-(cyclopentylmethyl)-1H-imidazol-5-yl]methyl]-2-(3-methylbut-2-enyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-[[2-(cyclopentylmethyl)-1H-imidazol-5-yl]methyl]-2-(3-methylbut-2-enyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133122890 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (3aS,6aS)-5-[[2-(cyclopentylmethyl)-1H-imidazol-5-yl]methyl]-2-(3-methylbut-2-enyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CC(C)=CCN1C[C@H]2CN(Cc3cnc(CC4CCCC4)[nH]3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C22H34N4O2/c1-16(2)7-8-25-11-18-12-26(15-22(18,14-25)21(27)28)13-19-10-23-20(24-19)9-17-5-3-4-6-17/h7,10,17-18H,3-6,8-9,11-15H2,1-2H3,(H,23,24)(H,27,28)/t18-,22-/m0/s1 |
| InChIKey | PQEUWAMJJTZKKP-AVRDEDQJSA-N |
| XLogP | 2.93 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|