C19H23FN2O5 — CID 133123382
methyl (1R,3S,3aR,6aS)-1-(5-fluoro-2-hydroxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 133123382) has the molecular formula C19H23FN2O5 and a molecular weight of 378.40 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-1-(5-fluoro-2-hydroxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-1-(5-fluoro-2-hydroxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 133123382 |
| Molecular Formula | C19H23FN2O5 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-1-(5-fluoro-2-hydroxyphenyl)-5-methyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(CC(C)C)N[C@@H](c2cc(F)ccc2O)[C@H]2C(=O)N(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C19H23FN2O5/c1-9(2)8-19(18(26)27-4)14-13(16(24)22(3)17(14)25)15(21-19)11-7-10(20)5-6-12(11)23/h5-7,9,13-15,21,23H,8H2,1-4H3/t13-,14-,15-,19-/m0/s1 |
| InChIKey | ZJCVKTOAFTUGJE-XLPNERPQSA-N |
| XLogP | 1.36 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|