C20H31N3O3 — CID 133123747
(1S,7R)-6-(4-methyl-1,4-diazepane-1-carbonyl)-3-pentan-3-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 133123747) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is (1S,7R)-6-(4-methyl-1,4-diazepane-1-carbonyl)-3-pentan-3-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1S,7R)-6-(4-methyl-1,4-diazepane-1-carbonyl)-3-pentan-3-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 133123747 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (1S,7R)-6-(4-methyl-1,4-diazepane-1-carbonyl)-3-pentan-3-yl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | CCC(CC)N1C[C@@]23C=C[C@@H](O2)C(C(=O)N2CCCN(C)CC2)C3C1=O |
| InChI | InChI=1S/C20H31N3O3/c1-4-14(5-2)23-13-20-8-7-15(26-20)16(17(20)19(23)25)18(24)22-10-6-9-21(3)11-12-22/h7-8,14-17H,4-6,9-13H2,1-3H3/t15-,16?,17?,20-/m1/s1 |
| InChIKey | QNIISZIIRGJVBZ-FLAIETJXSA-N |
| XLogP | 1.12 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|