C20H25NO4 — CID 133124285
1-[(3R,4R)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 133124285) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-[(3R,4R)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[(3R,4R)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 133124285 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[(3R,4R)-3-hydroxy-4-naphthalen-2-ylpiperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CC[C@H](c2ccc3ccccc3c2)[C@@H](O)C1 |
| InChI | InChI=1S/C20H25NO4/c1-24-10-11-25-14-20(23)21-9-8-18(19(22)13-21)17-7-6-15-4-2-3-5-16(15)12-17/h2-7,12,18-19,22H,8-11,13-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | DPZVGHOJSORNNN-MOPGFXCFSA-N |
| XLogP | 2.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|