About [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate
[(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate (PubChem CID 133124490) has the molecular formula C10H17BrO5S
and a molecular weight of 329.21 g/mol. Its IUPAC name is [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate.
Molecular Properties
| Compound Name | [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate |
| PubChem CID | 133124490 |
| Molecular Formula | C10H17BrO5S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate |
| SMILES | CC1(C)C2CC(=O)[C@]1(CS(=O)(=O)O)CC2Br.O |
| InChI | InChI=1S/C10H15BrO4S.H2O/c1-9(2)6-3-8(12)10(9,4-7(6)11)5-16(13,14)15;/h6-7H,3-5H2,1-2H3,(H,13,14,15);1H2/t6?,7?,10-;/m1./s1 |
| InChIKey | IPKWRBMRQCDUBL-KUZQZCPWSA-N |
| XLogP | 0.82 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate?
The IUPAC name of [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate (CID 133124490) is [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate.
What is the SMILES notation for [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate?
The canonical SMILES for [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate is CC1(C)C2CC(=O)[C@]1(CS(=O)(=O)O)CC2Br.O.
What is the InChIKey of [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate?
The InChIKey is IPKWRBMRQCDUBL-KUZQZCPWSA-N. The full InChI is InChI=1S/C10H15BrO4S.H2O/c1-9(2)6-3-8(12)10(9,4-7(6)11)5-16(13,14)15;/h6-7H,3-5H2,1-2H3,(H,13,14,15);1H2/t6?,7?,10-;/m1./s1.
What are the key properties of [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate?
[(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate has a molecular weight of 329.21 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate is sourced from PubChem (CID 133124490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).