C20H23N3O — CID 133124608
(3R,4R)-1-[(1-methylimidazol-2-yl)methyl]-4-naphthalen-2-ylpiperidin-3-ol (PubChem CID 133124608) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (3R,4R)-1-[(1-methylimidazol-2-yl)methyl]-4-naphthalen-2-ylpiperidin-3-ol.
| Compound Name | (3R,4R)-1-[(1-methylimidazol-2-yl)methyl]-4-naphthalen-2-ylpiperidin-3-ol |
|---|---|
| PubChem CID | 133124608 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (3R,4R)-1-[(1-methylimidazol-2-yl)methyl]-4-naphthalen-2-ylpiperidin-3-ol |
| SMILES | Cn1ccnc1CN1CC[C@H](c2ccc3ccccc3c2)[C@@H](O)C1 |
| InChI | InChI=1S/C20H23N3O/c1-22-11-9-21-20(22)14-23-10-8-18(19(24)13-23)17-7-6-15-4-2-3-5-16(15)12-17/h2-7,9,11-12,18-19,24H,8,10,13-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | BYNQYRZOWYKYGQ-MOPGFXCFSA-N |
| XLogP | 2.92 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |