C16H25N5O3S — CID 133125113
(4aR,7aS)-4-[2-(2,2-dimethylmorpholin-4-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133125113) has the molecular formula C16H25N5O3S and a molecular weight of 367.48 g/mol. Its IUPAC name is (4aR,7aS)-4-[2-(2,2-dimethylmorpholin-4-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[2-(2,2-dimethylmorpholin-4-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133125113 |
| Molecular Formula | C16H25N5O3S |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (4aR,7aS)-4-[2-(2,2-dimethylmorpholin-4-yl)pyrimidin-4-yl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC1(C)CN(c2nccc(N3CCN[C@@H]4CS(=O)(=O)C[C@@H]43)n2)CCO1 |
| InChI | InChI=1S/C16H25N5O3S/c1-16(2)11-20(7-8-24-16)15-18-4-3-14(19-15)21-6-5-17-12-9-25(22,23)10-13(12)21/h3-4,12-13,17H,5-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | QWXAESSQDDSRHC-OLZOCXBDSA-N |
| XLogP | -0.33 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |