About (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one
(1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one (PubChem CID 133125265) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one.
Molecular Properties
| Compound Name | (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| PubChem CID | 133125265 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| SMILES | O=C1C[C@@H]2CC[C@H](CN1)N2C1CCSCC1 |
| InChI | InChI=1S/C12H20N2OS/c15-12-7-10-1-2-11(8-13-12)14(10)9-3-5-16-6-4-9/h9-11H,1-8H2,(H,13,15)/t10-,11+/m0/s1 |
| InChIKey | AUSRIMFAZLVZLZ-WDEREUQCSA-N |
| XLogP | 1.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The IUPAC name of (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one (CID 133125265) is (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one.
What is the SMILES notation for (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The canonical SMILES for (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one is O=C1C[C@@H]2CC[C@H](CN1)N2C1CCSCC1.
What is the InChIKey of (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The InChIKey is AUSRIMFAZLVZLZ-WDEREUQCSA-N. The full InChI is InChI=1S/C12H20N2OS/c15-12-7-10-1-2-11(8-13-12)14(10)9-3-5-16-6-4-9/h9-11H,1-8H2,(H,13,15)/t10-,11+/m0/s1.
What are the key properties of (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
(1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one has a molecular weight of 240.37 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-9-(thian-4-yl)-3,9-diazabicyclo[4.2.1]nonan-4-one is sourced from PubChem (CID 133125265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).