C16H26N6O2S — CID 133125405
[1-[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]piperidin-4-yl]methanamine (PubChem CID 133125405) has the molecular formula C16H26N6O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is [1-[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]piperidin-4-yl]methanamine.
| Compound Name | [1-[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 133125405 |
| Molecular Formula | C16H26N6O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [1-[4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]pyrimidin-2-yl]piperidin-4-yl]methanamine |
| SMILES | NCC1CCN(c2nccc(N3CCN[C@@H]4CS(=O)(=O)C[C@@H]43)n2)CC1 |
| InChI | InChI=1S/C16H26N6O2S/c17-9-12-2-6-21(7-3-12)16-19-4-1-15(20-16)22-8-5-18-13-10-25(23,24)11-14(13)22/h1,4,12-14,18H,2-3,5-11,17H2/t13-,14+/m1/s1 |
| InChIKey | AUNGYUHSFZABAI-KGLIPLIRSA-N |
| XLogP | -0.77 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |