C21H23NO3S — CID 133125939
7-[[(3R,4S)-3-hydroxy-4-(3-methylthiophen-2-yl)piperidin-1-yl]methyl]-4-methylchromen-2-one (PubChem CID 133125939) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 7-[[(3R,4S)-3-hydroxy-4-(3-methylthiophen-2-yl)piperidin-1-yl]methyl]-4-methylchromen-2-one.
| Compound Name | 7-[[(3R,4S)-3-hydroxy-4-(3-methylthiophen-2-yl)piperidin-1-yl]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 133125939 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 7-[[(3R,4S)-3-hydroxy-4-(3-methylthiophen-2-yl)piperidin-1-yl]methyl]-4-methylchromen-2-one |
| SMILES | Cc1ccsc1[C@H]1CCN(Cc2ccc3c(C)cc(=O)oc3c2)C[C@@H]1O |
| InChI | InChI=1S/C21H23NO3S/c1-13-6-8-26-21(13)17-5-7-22(12-18(17)23)11-15-3-4-16-14(2)9-20(24)25-19(16)10-15/h3-4,6,8-10,17-18,23H,5,7,11-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KZVAITFFQDVOLB-ROUUACIJSA-N |
| XLogP | 3.82 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|