C28H36N2O4 — CID 133126069
(4aS,8aR)-6-[(E)-2-methyl-3-phenylprop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133126069) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (4aS,8aR)-6-[(E)-2-methyl-3-phenylprop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(E)-2-methyl-3-phenylprop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133126069 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (4aS,8aR)-6-[(E)-2-methyl-3-phenylprop-2-enyl]-1-[(3,4,5-trimethoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1cc(CN2C(=O)CC[C@H]3CN(C/C(C)=C/c4ccccc4)CC[C@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C28H36N2O4/c1-20(14-21-8-6-5-7-9-21)17-29-13-12-24-23(19-29)10-11-27(31)30(24)18-22-15-25(32-2)28(34-4)26(16-22)33-3/h5-9,14-16,23-24H,10-13,17-19H2,1-4H3/b20-14+/t23-,24+/m0/s1 |
| InChIKey | HYAZFLGFQYKDEE-MRROAGHWSA-N |
| XLogP | 4.63 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |