C12H19N5O2S — CID 133126299
4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 133126299) has the molecular formula C12H19N5O2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 133126299 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[(4aR,7aS)-6,6-dioxo-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazin-4-yl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nccc(N2CCN[C@@H]3CS(=O)(=O)C[C@@H]32)n1 |
| InChI | InChI=1S/C12H19N5O2S/c1-16(2)12-14-4-3-11(15-12)17-6-5-13-9-7-20(18,19)8-10(9)17/h3-4,9-10,13H,5-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | RDNJVRFNYNHFLU-ZJUUUORDSA-N |
| XLogP | -0.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |