About O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine
O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine (PubChem CID 13312705) has the molecular formula C5H7ClN2O2
and a molecular weight of 162.58 g/mol. Its IUPAC name is O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine |
| PubChem CID | 13312705 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine |
| SMILES | Cc1noc(CON)c1Cl |
| InChI | InChI=1S/C5H7ClN2O2/c1-3-5(6)4(2-9-7)10-8-3/h2,7H2,1H3 |
| InChIKey | YYNUTCHFWJHJBY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine?
The IUPAC name of O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine (CID 13312705) is O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine is Cc1noc(CON)c1Cl.
What is the InChIKey of O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine?
The InChIKey is YYNUTCHFWJHJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O2/c1-3-5(6)4(2-9-7)10-8-3/h2,7H2,1H3.
What are the key properties of O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine?
O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine has a molecular weight of 162.58 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(4-chloro-3-methyl-1,2-oxazol-5-yl)methyl]hydroxylamine is sourced from PubChem (CID 13312705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).