About 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione
4-thiophen-2-yl-1,3-oxazolidine-2,5-dione (PubChem CID 13312725) has the molecular formula C7H5NO3S
and a molecular weight of 183.19 g/mol. Its IUPAC name is 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione.
Molecular Properties
| Compound Name | 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione |
| PubChem CID | 13312725 |
| Molecular Formula | C7H5NO3S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1NC(c2cccs2)C(=O)O1 |
| InChI | InChI=1S/C7H5NO3S/c9-6-5(8-7(10)11-6)4-2-1-3-12-4/h1-3,5H,(H,8,10) |
| InChIKey | MNHDQIFZRXBBJW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione?
The IUPAC name of 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione (CID 13312725) is 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione.
What is the SMILES notation for 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione?
The canonical SMILES for 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione is O=C1NC(c2cccs2)C(=O)O1.
What is the InChIKey of 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione?
The InChIKey is MNHDQIFZRXBBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c9-6-5(8-7(10)11-6)4-2-1-3-12-4/h1-3,5H,(H,8,10).
What are the key properties of 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione?
4-thiophen-2-yl-1,3-oxazolidine-2,5-dione has a molecular weight of 183.19 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-yl-1,3-oxazolidine-2,5-dione is sourced from PubChem (CID 13312725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).