C21H29N3O2 — CID 133127552
(1R,5S)-6-(pyridin-2-ylmethyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 133127552) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (1R,5S)-6-(pyridin-2-ylmethyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1R,5S)-6-(pyridin-2-ylmethyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 133127552 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (1R,5S)-6-(pyridin-2-ylmethyl)-3-(2,2,3,3-tetramethylcyclopropanecarbonyl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CC1(C)C(C(=O)N2C[C@H]3CC[C@@H](C2)N(Cc2ccccn2)C3=O)C1(C)C |
| InChI | InChI=1S/C21H29N3O2/c1-20(2)17(21(20,3)4)19(26)23-11-14-8-9-16(13-23)24(18(14)25)12-15-7-5-6-10-22-15/h5-7,10,14,16-17H,8-9,11-13H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | GQVTXTSGRVACRJ-ZBFHGGJFSA-N |
| XLogP | 2.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |